Products 1788105-63-4
CAS 1788105-63-4 is the registry number for ATD-3169. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-hydroxytetracyclo[10.2.1.02,11.04,9]pentadeca-4(9),5,7-triene-3,10-dione (CAS 1788105-63-4) is a chemical compound with the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. IUPAC name: 5-hydroxytetracyclo[10.2.1.02,11.04,9]pentadeca-4(9),5,7-triene-3,10-dione. InChIKey: WYDIIVYARKSSJU-UHFFFAOYSA-N.
| Molecular formula | C15H14O3 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | 5-hydroxytetracyclo[10.2.1.02,11.04,9]pentadeca-4(9),5,7-triene-3,10-dione |
| InChIKey | WYDIIVYARKSSJU-UHFFFAOYSA-N |
| SMILES | C1CC2CC1C3C2C(=O)C4=C(C3=O)C=CC=C4O |
Computed by PubChem (NCBI)