CAS 178859-78-4 is the registry number for (S)-2-Acetamido-6-oxopimelic acid. Offered by: MedChemExpress. Available pack sizes: Get quote.
(S)-2-acetamido-6-oxopimelic acid is a dicarboxylic fatty acid, an oxo dicarboxylic acid and a N-acyl-amino acid. It is functionally related to a (S)-2-amino-6-oxopimelic acid. It is a conjugate acid of a (S)-2-acetamido-6-oxopimelate(2-).
Source: ChEBI
| Molecular formula | C9H13NO6 |
|---|---|
| Molecular weight | 231.20 g/mol |
| IUPAC name | (2S)-2-acetamido-6-oxoheptanedioic acid |
| InChIKey | RVHKMLVNOXVQRH-LURJTMIESA-N |
| SMILES | CC(=O)N[C@@H](CCCC(=O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)