Products 996-75-8

CAS 996-75-8 is the registry number for 2-(Hydroxyimino)-3-oxo-pentanedioic Acid 1,5-Diethyl Ester. Offered by: TRC. Available pack sizes: 10mg, 25mg, 50mg.

Structural formula: {0} (CAS {1})

Diethyl (E)-3-hydroxy-2-nitrosopent-2-enedioate (CAS 996-75-8) is a chemical compound with the molecular formula C9H13NO6 and a molecular weight of 231.20 g/mol. IUPAC name: diethyl (E)-3-hydroxy-2-nitrosopent-2-enedioate. InChIKey: JZIKFPIGLULSOV-SOFGYWHQSA-N.

Identity
Molecular formulaC9H13NO6
Molecular weight231.20 g/mol
IUPAC namediethyl (E)-3-hydroxy-2-nitrosopent-2-enedioate
InChIKeyJZIKFPIGLULSOV-SOFGYWHQSA-N
SMILESCCOC(=O)C/C(=C(/C(=O)OCC)\N=O)/O

Computed by PubChem (NCBI)