CAS 996-75-8 is the registry number for 2-(Hydroxyimino)-3-oxo-pentanedioic Acid 1,5-Diethyl Ester. Offered by: TRC. Available pack sizes: 10mg, 25mg, 50mg.
Diethyl (E)-3-hydroxy-2-nitrosopent-2-enedioate (CAS 996-75-8) is a chemical compound with the molecular formula C9H13NO6 and a molecular weight of 231.20 g/mol. IUPAC name: diethyl (E)-3-hydroxy-2-nitrosopent-2-enedioate. InChIKey: JZIKFPIGLULSOV-SOFGYWHQSA-N.
| Molecular formula | C9H13NO6 |
|---|---|
| Molecular weight | 231.20 g/mol |
| IUPAC name | diethyl (E)-3-hydroxy-2-nitrosopent-2-enedioate |
| InChIKey | JZIKFPIGLULSOV-SOFGYWHQSA-N |
| SMILES | CCOC(=O)C/C(=C(/C(=O)OCC)\N=O)/O |
Computed by PubChem (NCBI)