Products 178877-03-7

CAS 178877-03-7 is the registry number for Ethyl 4-(benzyloxy)-7-bromo-2-naphthoate. Offered by: Biosynth. Available pack sizes: 500mg, 250mg, 1000mg, 5000mg.

Structural formula: {0} (CAS {1})

Ethyl 7-bromo-4-phenylmethoxynaphthalene-2-carboxylate (CAS 178877-03-7) is a chemical compound with the molecular formula C20H17BrO3 and a molecular weight of 385.2 g/mol. IUPAC name: ethyl 7-bromo-4-phenylmethoxynaphthalene-2-carboxylate. InChIKey: SUMFTPPRKZGIBN-UHFFFAOYSA-N.

Identity
Molecular formulaC20H17BrO3
Molecular weight385.2 g/mol
IUPAC nameethyl 7-bromo-4-phenylmethoxynaphthalene-2-carboxylate
InChIKeySUMFTPPRKZGIBN-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC(=C2C=CC(=CC2=C1)Br)OCC3=CC=CC=C3

Computed by PubChem (NCBI)