Products 2770448-53-6
CAS 2770448-53-6 appears in our catalog under these names: Nrf2 activator–2, Nrf2 activator-2, 99.20%, Nrf2 activator-2, ≥95%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 1mg, 10mg, 25mg, 5mg, 5 mg, 10mM/1mL, 10 mg, 50 mg.
6-bromo-8,8-dimethyl-3-phenyl-9,10-dihydropyrano[2,3-h]chromen-2-one (CAS 2770448-53-6) is a chemical compound with the molecular formula C20H17BrO3 and a molecular weight of 385.2 g/mol. IUPAC name: 6-bromo-8,8-dimethyl-3-phenyl-9,10-dihydropyrano[2,3-h]chromen-2-one. InChIKey: AWBUMGZRUKQFIN-UHFFFAOYSA-N.
| Molecular formula | C20H17BrO3 |
|---|---|
| Molecular weight | 385.2 g/mol |
| IUPAC name | 6-bromo-8,8-dimethyl-3-phenyl-9,10-dihydropyrano[2,3-h]chromen-2-one |
| InChIKey | AWBUMGZRUKQFIN-UHFFFAOYSA-N |
| SMILES | CC1(CCC2=C3C(=CC(=C2O1)Br)C=C(C(=O)O3)C4=CC=CC=C4)C |
Computed by PubChem (NCBI)
Synonyms:
Nrf2 activator-2