CAS 1788860-72-9 is the registry number for 5'-Bromo-2'-cyclopropylspiro[cyclohexane-1,3'-indoline], 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-2-cyclopropylspiro[1,2-dihydroindole-3,1'-cyclohexane] (CAS 1788860-72-9) is a chemical compound with the molecular formula C16H20BrN and a molecular weight of 306.24 g/mol. IUPAC name: 5-bromo-2-cyclopropylspiro[1,2-dihydroindole-3,1'-cyclohexane]. InChIKey: BKSBYAHPNIEZQC-UHFFFAOYSA-N.
| Molecular formula | C16H20BrN |
|---|---|
| Molecular weight | 306.24 g/mol |
| IUPAC name | 5-bromo-2-cyclopropylspiro[1,2-dihydroindole-3,1'-cyclohexane] |
| InChIKey | BKSBYAHPNIEZQC-UHFFFAOYSA-N |
| SMILES | C1CCC2(CC1)C(NC3=C2C=C(C=C3)Br)C4CC4 |
Computed by PubChem (NCBI)