CAS 1794737-27-1 is the registry number for Bromantane-d5. Offered by: TRC, Biosynth. Available pack sizes: 25mg, 50mg, 5mg, 10mg.
N-(4-bromo-2,3,5,6-tetradeuteriophenyl)-2-deuterioadamantan-2-amine (CAS 1794737-27-1) is a chemical compound with the molecular formula C16H20BrN and a molecular weight of 311.27 g/mol. IUPAC name: N-(4-bromo-2,3,5,6-tetradeuteriophenyl)-2-deuterioadamantan-2-amine. InChIKey: LWJALJDRFBXHKX-IPPIDYIJSA-N.
| Molecular formula | C16H20BrN |
|---|---|
| Molecular weight | 311.27 g/mol |
| IUPAC name | N-(4-bromo-2,3,5,6-tetradeuteriophenyl)-2-deuterioadamantan-2-amine |
| InChIKey | LWJALJDRFBXHKX-IPPIDYIJSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1NC2(C3CC4CC(C3)CC2C4)[2H])[2H])[2H])Br)[2H] |
Computed by PubChem (NCBI)