CAS 179024-66-9 appears in our catalog under these names: 4-Chloro-3-quinolinecarboxylic Acid, 4-Chloroquinoline-3-carboxylic acid, 95%, 4-Chloroquinoline-3-carboxylic acid, 95%, 95%. Offered by: TRC, AmBeed, Chemat, Fluorochem. Available pack sizes: 500mg, 5g, 10g, 1g, 100mg, 250mg.
4-chloroquinoline-3-carboxylic acid (CAS 179024-66-9) is a chemical compound with the molecular formula C10H6ClNO2 and a molecular weight of 207.61 g/mol. IUPAC name: 4-chloroquinoline-3-carboxylic acid. InChIKey: HJSCQRDGGJZGJH-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO2 |
|---|---|
| Molecular weight | 207.61 g/mol |
| IUPAC name | 4-chloroquinoline-3-carboxylic acid |
| InChIKey | HJSCQRDGGJZGJH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(C=N2)C(=O)O)Cl |
Computed by PubChem (NCBI)