CAS 179033-21-7 appears in our catalog under these names: 2-(2,6-Dioxopiperidin-3-yl)-4,5,6,7-tetrafluoroisoindoline-1,3-dione, 98%, Tetrafluoro-thalidomide. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
2-(2,6-dioxopiperidin-3-yl)-4,5,6,7-tetrafluoroisoindole-1,3-dione (CAS 179033-21-7) is a chemical compound with the molecular formula C13H6F4N2O4 and a molecular weight of 330.19 g/mol. IUPAC name: 2-(2,6-dioxopiperidin-3-yl)-4,5,6,7-tetrafluoroisoindole-1,3-dione. InChIKey: PIJMHCCGPUSELZ-UHFFFAOYSA-N.
| Molecular formula | C13H6F4N2O4 |
|---|---|
| Molecular weight | 330.19 g/mol |
| IUPAC name | 2-(2,6-dioxopiperidin-3-yl)-4,5,6,7-tetrafluoroisoindole-1,3-dione |
| InChIKey | PIJMHCCGPUSELZ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C(=C(C(=C3F)F)F)F |
Computed by PubChem (NCBI)