CAS 2365418-96-6 is the registry number for 4-(2,4-dinitrophenyl)-1-fluoro-2-(trifluoromethyl)benzene, 84%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
4-(2,4-dinitrophenyl)-1-fluoro-2-(trifluoromethyl)benzene (CAS 2365418-96-6) is a chemical compound with the molecular formula C13H6F4N2O4 and a molecular weight of 330.19 g/mol. IUPAC name: 4-(2,4-dinitrophenyl)-1-fluoro-2-(trifluoromethyl)benzene. InChIKey: RNGMSPQZLXAIKY-UHFFFAOYSA-N.
| Molecular formula | C13H6F4N2O4 |
|---|---|
| Molecular weight | 330.19 g/mol |
| IUPAC name | 4-(2,4-dinitrophenyl)-1-fluoro-2-(trifluoromethyl)benzene |
| InChIKey | RNGMSPQZLXAIKY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=C(C=C(C=C2)[N+](=O)[O-])[N+](=O)[O-])C(F)(F)F)F |
Computed by PubChem (NCBI)