Products 179039-97-5
CAS 179039-97-5 is the registry number for tert-Butyl (S)-2-((1R,2R)-1,3-dimethoxy-2-methyl-3-oxopropyl)pyrrolidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (2S)-2-[(1R,2R)-1,3-dimethoxy-2-methyl-3-oxopropyl]pyrrolidine-1-carboxylate (CAS 179039-97-5) is a chemical compound with the molecular formula C15H27NO5 and a molecular weight of 301.38 g/mol. IUPAC name: tert-butyl (2S)-2-[(1R,2R)-1,3-dimethoxy-2-methyl-3-oxopropyl]pyrrolidine-1-carboxylate. InChIKey: OUDIZTOACCWIRY-GRYCIOLGSA-N.
| Molecular formula | C15H27NO5 |
|---|---|
| Molecular weight | 301.38 g/mol |
| IUPAC name | tert-butyl (2S)-2-[(1R,2R)-1,3-dimethoxy-2-methyl-3-oxopropyl]pyrrolidine-1-carboxylate |
| InChIKey | OUDIZTOACCWIRY-GRYCIOLGSA-N |
| SMILES | C[C@H]([C@H]([C@@H]1CCCN1C(=O)OC(C)(C)C)OC)C(=O)OC |
Computed by PubChem (NCBI)