CAS 945859-84-7 appears in our catalog under these names: tert-Butyl (2S)-2-{[(tert-butoxy)carbonyl]amino}-5-oxohexanoate, 95%, (S)-tert-Butyl 2-((tert-butoxycarbonyl)amino)-5-oxohexanoate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
Tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxohexanoate (CAS 945859-84-7) is a chemical compound with the molecular formula C15H27NO5 and a molecular weight of 301.38 g/mol. IUPAC name: tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxohexanoate. InChIKey: GZEIQAMBCYFOGL-NSHDSACASA-N.
| Molecular formula | C15H27NO5 |
|---|---|
| Molecular weight | 301.38 g/mol |
| IUPAC name | tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxohexanoate |
| InChIKey | GZEIQAMBCYFOGL-NSHDSACASA-N |
| SMILES | CC(=O)CC[C@@H](C(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)