Products 111276-71-2

CAS 111276-71-2 is the registry number for Caproyl-L-Glutamic Acid (Decanoyl-L-Glutamic Acid). Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(2S)-2-(decanoylamino)pentanedioic acid (CAS 111276-71-2) is a chemical compound with the molecular formula C15H27NO5 and a molecular weight of 301.38 g/mol. IUPAC name: (2S)-2-(decanoylamino)pentanedioic acid. InChIKey: OBACDZMAJJOBJC-LBPRGKRZSA-N.

Identity
Molecular formulaC15H27NO5
Molecular weight301.38 g/mol
IUPAC name(2S)-2-(decanoylamino)pentanedioic acid
InChIKeyOBACDZMAJJOBJC-LBPRGKRZSA-N
SMILESCCCCCCCCCC(=O)N[C@@H](CCC(=O)O)C(=O)O

Computed by PubChem (NCBI)