CAS 17909-87-4 is the registry number for cis-beta-Sinensal . Offered by: Chemat Brand. Available pack sizes: on request.
(2E,6Z)-2,6-dimethyl-10-methylidenedodeca-2,6,11-trienal (CAS 17909-87-4) is a chemical compound with the molecular formula C15H22O and a molecular weight of 218.33 g/mol. IUPAC name: (2E,6Z)-2,6-dimethyl-10-methylidenedodeca-2,6,11-trienal. InChIKey: NOPLRNXKHZRXHT-GNESMGCMSA-N.
| Molecular formula | C15H22O |
|---|---|
| Molecular weight | 218.33 g/mol |
| IUPAC name | (2E,6Z)-2,6-dimethyl-10-methylidenedodeca-2,6,11-trienal |
| InChIKey | NOPLRNXKHZRXHT-GNESMGCMSA-N |
| SMILES | C/C(=C/CCC(=C)C=C)/CC/C=C(\C)/C=O |
Computed by PubChem (NCBI)