CAS 473-08-5 appears in our catalog under these names: Alpha-cyperone, 95%, (+)-a-Cyperone, (+)-Alpha-Cyperone, α–Cyperone, alpha-Cyperone/ 99.91% (existing batch purity). Offered by: Combi-blocks, TRC, GLPBio, TargetMol, Chemat. Available pack sizes: 100mg, 10mg, 20mg, 5mg, 25mg, 50mg, 1mg, 50 mg.
(4aS,7R)-1,4a-dimethyl-7-prop-1-en-2-yl-3,4,5,6,7,8-hexahydronaphthalen-2-one (CAS 473-08-5) is a chemical compound with the molecular formula C15H22O and a molecular weight of 218.33 g/mol. IUPAC name: (4aS,7R)-1,4a-dimethyl-7-prop-1-en-2-yl-3,4,5,6,7,8-hexahydronaphthalen-2-one. InChIKey: KUFXJZXMWHNCEH-DOMZBBRYSA-N.
| Molecular formula | C15H22O |
|---|---|
| Molecular weight | 218.33 g/mol |
| IUPAC name | (4aS,7R)-1,4a-dimethyl-7-prop-1-en-2-yl-3,4,5,6,7,8-hexahydronaphthalen-2-one |
| InChIKey | KUFXJZXMWHNCEH-DOMZBBRYSA-N |
| SMILES | CC1=C2C[C@@H](CC[C@]2(CCC1=O)C)C(=C)C |
Computed by PubChem (NCBI)