CAS 1791455-27-0 is the registry number for (S)-3,3'-Diphenyl-[1,1'-binaphthalene]-2,2'-dicarboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2-carboxy-3-phenylnaphthalen-1-yl)-3-phenylnaphthalene-2-carboxylic acid (CAS 1791455-27-0) is a chemical compound with the molecular formula C34H22O4 and a molecular weight of 494.5 g/mol. IUPAC name: 1-(2-carboxy-3-phenylnaphthalen-1-yl)-3-phenylnaphthalene-2-carboxylic acid. InChIKey: IVGPJIAUOXGSJE-UHFFFAOYSA-N.
| Molecular formula | C34H22O4 |
|---|---|
| Molecular weight | 494.5 g/mol |
| IUPAC name | 1-(2-carboxy-3-phenylnaphthalen-1-yl)-3-phenylnaphthalene-2-carboxylic acid |
| InChIKey | IVGPJIAUOXGSJE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=CC=CC=C3C(=C2C(=O)O)C4=C(C(=CC5=CC=CC=C54)C6=CC=CC=C6)C(=O)O |
Computed by PubChem (NCBI)