CAS 291772-40-2 is the registry number for (S)-[1,1'-Binaphthalene]-2,2'-diyl dibenzoate, 98%, 98%. Offered by: Chemat. Available pack sizes: 250mg, 1g.
[1-(2-benzoyloxynaphthalen-1-yl)naphthalen-2-yl] benzoate (CAS 291772-40-2) is a chemical compound with the molecular formula C34H22O4 and a molecular weight of 494.5 g/mol. IUPAC name: [1-(2-benzoyloxynaphthalen-1-yl)naphthalen-2-yl] benzoate. InChIKey: DYTFOMFSASUHEX-UHFFFAOYSA-N.
| Molecular formula | C34H22O4 |
|---|---|
| Molecular weight | 494.5 g/mol |
| IUPAC name | [1-(2-benzoyloxynaphthalen-1-yl)naphthalen-2-yl] benzoate |
| InChIKey | DYTFOMFSASUHEX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OC2=C(C3=CC=CC=C3C=C2)C4=C(C=CC5=CC=CC=C54)OC(=O)C6=CC=CC=C6 |
Computed by PubChem (NCBI)