CAS 1792171-85-7 is the registry number for 1-Bromo-3-chloro-9H-carbazole, 98%, 98%. Offered by: Chemat. Available pack sizes: 25g.
1-bromo-3-chloro-9H-carbazole (CAS 1792171-85-7) is a chemical compound with the molecular formula C12H7BrClN and a molecular weight of 280.55 g/mol. IUPAC name: 1-bromo-3-chloro-9H-carbazole. InChIKey: OYNMHANIWGBQHI-UHFFFAOYSA-N.
| Molecular formula | C12H7BrClN |
|---|---|
| Molecular weight | 280.55 g/mol |
| IUPAC name | 1-bromo-3-chloro-9H-carbazole |
| InChIKey | OYNMHANIWGBQHI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C(=CC(=C3)Cl)Br |
Computed by PubChem (NCBI)