CAS 2127377-11-9 is the registry number for 1–Bromo–4–Chloro–9H–Carbazole. Offered by: GLPBio. Available pack sizes: 1g, 5g.
1-bromo-4-chloro-9H-carbazole (CAS 2127377-11-9) is a chemical compound with the molecular formula C12H7BrClN and a molecular weight of 280.55 g/mol. IUPAC name: 1-bromo-4-chloro-9H-carbazole. InChIKey: FZXBQUOJWSANJI-UHFFFAOYSA-N.
| Molecular formula | C12H7BrClN |
|---|---|
| Molecular weight | 280.55 g/mol |
| IUPAC name | 1-bromo-4-chloro-9H-carbazole |
| InChIKey | FZXBQUOJWSANJI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C=CC(=C3N2)Br)Cl |
Computed by PubChem (NCBI)