CAS 179246-45-8 is the registry number for Lapatinib Impurity 15. Offered by: Chemat Brand. Available pack sizes: on request.
3-chloro-4-[(2-fluorophenyl)methoxy]aniline (CAS 179246-45-8) is a chemical compound with the molecular formula C13H11ClFNO and a molecular weight of 251.68 g/mol. IUPAC name: 3-chloro-4-[(2-fluorophenyl)methoxy]aniline. InChIKey: XFGRSRQUIAXQNB-UHFFFAOYSA-N.
| Molecular formula | C13H11ClFNO |
|---|---|
| Molecular weight | 251.68 g/mol |
| IUPAC name | 3-chloro-4-[(2-fluorophenyl)methoxy]aniline |
| InChIKey | XFGRSRQUIAXQNB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)COC2=C(C=C(C=C2)N)Cl)F |
Computed by PubChem (NCBI)