CAS 329779-41-1 appears in our catalog under these names: 2-([(3-Chloro-4-fluorophenyl)amino]methyl)phenol, 95%, 2-{((3-Chloro-4-fluorophenyl)amino)methyl}phenol. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 2,5g.
2-[(3-chloro-4-fluoroanilino)methyl]phenol (CAS 329779-41-1) is a chemical compound with the molecular formula C13H11ClFNO and a molecular weight of 251.68 g/mol. IUPAC name: 2-[(3-chloro-4-fluoroanilino)methyl]phenol. InChIKey: VAENDKVBNUCVBT-UHFFFAOYSA-N.
| Molecular formula | C13H11ClFNO |
|---|---|
| Molecular weight | 251.68 g/mol |
| IUPAC name | 2-[(3-chloro-4-fluoroanilino)methyl]phenol |
| InChIKey | VAENDKVBNUCVBT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CNC2=CC(=C(C=C2)F)Cl)O |
Computed by PubChem (NCBI)