Products 17928-63-1
CAS 17928-63-1 appears in our catalog under these names: Sugetriol 6，9–diacetate, Sugetriol 6,9-diacetate. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, Get quote.
[(1R,3S,6S,7S,9S,10S)-6-acetyloxy-3-hydroxy-4,10,11,11-tetramethyl-9-tricyclo[5.3.1.01,5]undec-4-enyl] acetate (CAS 17928-63-1) is a chemical compound with the molecular formula C19H28O5 and a molecular weight of 336.4 g/mol. IUPAC name: [(1R,3S,6S,7S,9S,10S)-6-acetyloxy-3-hydroxy-4,10,11,11-tetramethyl-9-tricyclo[5.3.1.01,5]undec-4-enyl] acetate. InChIKey: JYSMJRPERVTRSP-IECRSODLSA-N.
| Molecular formula | C19H28O5 |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | [(1R,3S,6S,7S,9S,10S)-6-acetyloxy-3-hydroxy-4,10,11,11-tetramethyl-9-tricyclo[5.3.1.01,5]undec-4-enyl] acetate |
| InChIKey | JYSMJRPERVTRSP-IECRSODLSA-N |
| SMILES | C[C@@H]1[C@H](C[C@@H]2[C@@H](C3=C([C@H](C[C@]13C2(C)C)O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)
Synonyms:
Sugetriol 6,9-diacetate, orb1991267