Products 2171506-78-6

CAS 2171506-78-6 is the registry number for 1,2-Benzenedicarboxylic Acid 1-(10-Hydroxyundecyl) Ester, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 2,5mg, 25mg.

Structural formula: {0} (CAS {1})

2-(10-hydroxyundecoxycarbonyl)benzoic acid (CAS 2171506-78-6) is a chemical compound with the molecular formula C19H28O5 and a molecular weight of 336.4 g/mol. IUPAC name: 2-(10-hydroxyundecoxycarbonyl)benzoic acid. InChIKey: KKVRBOVZYWVRRN-UHFFFAOYSA-N.

Identity
Molecular formulaC19H28O5
Molecular weight336.4 g/mol
IUPAC name2-(10-hydroxyundecoxycarbonyl)benzoic acid
InChIKeyKKVRBOVZYWVRRN-UHFFFAOYSA-N
SMILESCC(CCCCCCCCCOC(=O)C1=CC=CC=C1C(=O)O)O

Computed by PubChem (NCBI)