CAS 1793085-74-1 is the registry number for 4-Cumylphenol-2,6-d2, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 10mg, 50mg.
2,6-dideuterio-4-(2-phenylpropan-2-yl)phenol (CAS 1793085-74-1) is a chemical compound with the molecular formula C15H16O and a molecular weight of 214.30 g/mol. IUPAC name: 2,6-dideuterio-4-(2-phenylpropan-2-yl)phenol. InChIKey: QBDSZLJBMIMQRS-MIBQVNFTSA-N.
| Molecular formula | C15H16O |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | 2,6-dideuterio-4-(2-phenylpropan-2-yl)phenol |
| InChIKey | QBDSZLJBMIMQRS-MIBQVNFTSA-N |
| SMILES | [2H]C1=CC(=CC(=C1O)[2H])C(C)(C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)