Products 179334-11-3
CAS 179334-11-3 is the registry number for 1-(2,5-Difluorobenzoyl)piperazine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(2,5-difluorophenyl)-piperazin-1-ylmethanone (CAS 179334-11-3) is a chemical compound with the molecular formula C11H12F2N2O and a molecular weight of 226.22 g/mol. IUPAC name: (2,5-difluorophenyl)-piperazin-1-ylmethanone. InChIKey: MNUKRHGVCYWYPM-UHFFFAOYSA-N.
| Molecular formula | C11H12F2N2O |
|---|---|
| Molecular weight | 226.22 g/mol |
| IUPAC name | (2,5-difluorophenyl)-piperazin-1-ylmethanone |
| InChIKey | MNUKRHGVCYWYPM-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C(=O)C2=C(C=CC(=C2)F)F |
Computed by PubChem (NCBI)