CAS 874942-08-2 is the registry number for 1-(3,5-Difluorobenzoyl)piperazine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(3,5-difluorophenyl)-piperazin-1-ylmethanone (CAS 874942-08-2) is a chemical compound with the molecular formula C11H12F2N2O and a molecular weight of 226.22 g/mol. IUPAC name: (3,5-difluorophenyl)-piperazin-1-ylmethanone. InChIKey: VAPNINRCIQNTDD-UHFFFAOYSA-N.
| Molecular formula | C11H12F2N2O |
|---|---|
| Molecular weight | 226.22 g/mol |
| IUPAC name | (3,5-difluorophenyl)-piperazin-1-ylmethanone |
| InChIKey | VAPNINRCIQNTDD-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C(=O)C2=CC(=CC(=C2)F)F |
Computed by PubChem (NCBI)