CAS 179337-62-3 appears in our catalog under these names: 1-(4,5-Dihydrothiazol-2-yl)azetidin-3-yl methanesulfonate, 98%, Tebipenem Pivoxil Impurity 22. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
[1-(4,5-dihydro-1,3-thiazol-2-yl)azetidin-3-yl] methanesulfonate (CAS 179337-62-3) is a chemical compound with the molecular formula C7H12N2O3S2 and a molecular weight of 236.3 g/mol. IUPAC name: [1-(4,5-dihydro-1,3-thiazol-2-yl)azetidin-3-yl] methanesulfonate. InChIKey: OWONEHQFCRHLFE-UHFFFAOYSA-N.
| Molecular formula | C7H12N2O3S2 |
|---|---|
| Molecular weight | 236.3 g/mol |
| IUPAC name | [1-(4,5-dihydro-1,3-thiazol-2-yl)azetidin-3-yl] methanesulfonate |
| InChIKey | OWONEHQFCRHLFE-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OC1CN(C1)C2=NCCS2 |
Computed by PubChem (NCBI)