CAS 2408330-95-8 is the registry number for 2-(2-Hydroxypropan-2-yl)-4-methylthiazole-5-sulfonamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2-hydroxypropan-2-yl)-4-methyl-1,3-thiazole-5-sulfonamide (CAS 2408330-95-8) is a chemical compound with the molecular formula C7H12N2O3S2 and a molecular weight of 236.3 g/mol. IUPAC name: 2-(2-hydroxypropan-2-yl)-4-methyl-1,3-thiazole-5-sulfonamide. InChIKey: DJEYGJDMSUIVPU-UHFFFAOYSA-N.
| Molecular formula | C7H12N2O3S2 |
|---|---|
| Molecular weight | 236.3 g/mol |
| IUPAC name | 2-(2-hydroxypropan-2-yl)-4-methyl-1,3-thiazole-5-sulfonamide |
| InChIKey | DJEYGJDMSUIVPU-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C(C)(C)O)S(=O)(=O)N |
Computed by PubChem (NCBI)