Products 1794713-10-2
CAS 1794713-10-2 appears in our catalog under these names: Alpha-Amino-Beta-methylaminopropionic Acid-d3 Hydrochloride, >95% (HPLC), α–Amino–β–methylaminopropionic Acid–d3 Hydrochloride, α-Amino-β-methylaminopropionic acid-d3 (hydrochloride). Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 1 mg.
2-amino-3-(trideuteriomethylamino)propanoic acid;hydrochloride (CAS 1794713-10-2) is a chemical compound with the molecular formula C4H11ClN2O2 and a molecular weight of 157.61 g/mol. IUPAC name: 2-amino-3-(trideuteriomethylamino)propanoic acid;hydrochloride. InChIKey: VDXYGASOGLSIDM-NIIDSAIPSA-N.
| Molecular formula | C4H11ClN2O2 |
|---|---|
| Molecular weight | 157.61 g/mol |
| IUPAC name | 2-amino-3-(trideuteriomethylamino)propanoic acid;hydrochloride |
| InChIKey | VDXYGASOGLSIDM-NIIDSAIPSA-N |
| SMILES | [2H]C([2H])([2H])NCC(C(=O)O)N.Cl |
Computed by PubChem (NCBI)