CAS 209616-88-6 is the registry number for (2R,3S)-Rel-2-amino-3-hydroxybutanamide hydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 25g, 5g.
(2S,3R)-2-amino-3-hydroxybutanamide;hydrochloride (CAS 209616-88-6) is a chemical compound with the molecular formula C4H11ClN2O2 and a molecular weight of 154.59 g/mol. IUPAC name: (2S,3R)-2-amino-3-hydroxybutanamide;hydrochloride. InChIKey: LZQCOMULTLYITH-MUWMCQJSSA-N.
| Molecular formula | C4H11ClN2O2 |
|---|---|
| Molecular weight | 154.59 g/mol |
| IUPAC name | (2S,3R)-2-amino-3-hydroxybutanamide;hydrochloride |
| InChIKey | LZQCOMULTLYITH-MUWMCQJSSA-N |
| SMILES | C[C@H]([C@@H](C(=O)N)N)O.Cl |
Computed by PubChem (NCBI)