Products 1794713-40-8
CAS 1794713-40-8 is the registry number for 4-(Chloromethyl)-2,5-oxazolidinedione-d3. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
4-[chloro(dideuterio)methyl]-4-deuterio-1,3-oxazolidine-2,5-dione (CAS 1794713-40-8) is a chemical compound with the molecular formula C4H4ClNO3 and a molecular weight of 152.55 g/mol. IUPAC name: 4-[chloro(dideuterio)methyl]-4-deuterio-1,3-oxazolidine-2,5-dione. InChIKey: ALQADUBZEIRDQN-FUDHJZNOSA-N.
| Molecular formula | C4H4ClNO3 |
|---|---|
| Molecular weight | 152.55 g/mol |
| IUPAC name | 4-[chloro(dideuterio)methyl]-4-deuterio-1,3-oxazolidine-2,5-dione |
| InChIKey | ALQADUBZEIRDQN-FUDHJZNOSA-N |
| SMILES | [2H]C1(C(=O)OC(=O)N1)C([2H])([2H])Cl |
Computed by PubChem (NCBI)