CAS 96165-57-0 is the registry number for (S)-4-(Chloromethyl)oxazolidine-2,5-dione, 95%. Offered by: AmBeed. Available pack sizes: 5g.
(4S)-4-(chloromethyl)-1,3-oxazolidine-2,5-dione (CAS 96165-57-0) is a chemical compound with the molecular formula C4H4ClNO3 and a molecular weight of 149.53 g/mol. IUPAC name: (4S)-4-(chloromethyl)-1,3-oxazolidine-2,5-dione. InChIKey: ALQADUBZEIRDQN-UWTATZPHSA-N.
| Molecular formula | C4H4ClNO3 |
|---|---|
| Molecular weight | 149.53 g/mol |
| IUPAC name | (4S)-4-(chloromethyl)-1,3-oxazolidine-2,5-dione |
| InChIKey | ALQADUBZEIRDQN-UWTATZPHSA-N |
| SMILES | C([C@@H]1C(=O)OC(=O)N1)Cl |
Computed by PubChem (NCBI)