Products 1794752-32-1
CAS 1794752-32-1 is the registry number for Isophorone Diamine-d5 (Major) Dihydrochloride Salt (cis/trans Mixture), >95% (HPLC). Offered by: TRC. Available pack sizes: 1mg, 2,5mg, 25mg.
3-(aminomethyl)-4,4-dideuterio-5,5-dimethyl-3-(trideuteriomethyl)cyclohexan-1-amine;dihydrochloride (CAS 1794752-32-1) is a chemical compound with the molecular formula C10H24Cl2N2 and a molecular weight of 248.24 g/mol. IUPAC name: 3-(aminomethyl)-4,4-dideuterio-5,5-dimethyl-3-(trideuteriomethyl)cyclohexan-1-amine;dihydrochloride. InChIKey: UKBRFCIVTBJKPZ-WCKZLILGSA-N.
| Molecular formula | C10H24Cl2N2 |
|---|---|
| Molecular weight | 248.24 g/mol |
| IUPAC name | 3-(aminomethyl)-4,4-dideuterio-5,5-dimethyl-3-(trideuteriomethyl)cyclohexan-1-amine;dihydrochloride |
| InChIKey | UKBRFCIVTBJKPZ-WCKZLILGSA-N |
| SMILES | [2H]C1(C(CC(CC1(CN)C([2H])([2H])[2H])N)(C)C)[2H].Cl.Cl |
Computed by PubChem (NCBI)