Products 2287333-40-6

CAS 2287333-40-6 is the registry number for 2-(3,5-Dimethylpiperidin-1-yl)propan-1-amine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2-(3,5-dimethylpiperidin-1-yl)propan-1-amine;dihydrochloride (CAS 2287333-40-6) is a chemical compound with the molecular formula C10H24Cl2N2 and a molecular weight of 243.21 g/mol. IUPAC name: 2-(3,5-dimethylpiperidin-1-yl)propan-1-amine;dihydrochloride. InChIKey: DFPLTFDKYZQQNF-UHFFFAOYSA-N.

Identity
Molecular formulaC10H24Cl2N2
Molecular weight243.21 g/mol
IUPAC name2-(3,5-dimethylpiperidin-1-yl)propan-1-amine;dihydrochloride
InChIKeyDFPLTFDKYZQQNF-UHFFFAOYSA-N
SMILESCC1CC(CN(C1)C(C)CN)C.Cl.Cl

Computed by PubChem (NCBI)