Products 1187927-93-0

CAS 1187927-93-0 is the registry number for N1,N1-Diethylcyclohexane-1,4-diamine dihydrochloride, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

4-N,4-N-diethylcyclohexane-1,4-diamine;dihydrochloride (CAS 1187927-93-0) is a chemical compound with the molecular formula C10H24Cl2N2 and a molecular weight of 243.21 g/mol. IUPAC name: 4-N,4-N-diethylcyclohexane-1,4-diamine;dihydrochloride. InChIKey: JSGOAXICWAZNHJ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H24Cl2N2
Molecular weight243.21 g/mol
IUPAC name4-N,4-N-diethylcyclohexane-1,4-diamine;dihydrochloride
InChIKeyJSGOAXICWAZNHJ-UHFFFAOYSA-N
SMILESCCN(CC)C1CCC(CC1)N.Cl.Cl

Computed by PubChem (NCBI)