CAS 1794753-23-3 appears in our catalog under these names: 1-Nitropiperazine-d8, >95% (HPLC), 1-Nitropiperazine-d8. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
2,2,3,3,5,5,6,6-octadeuterio-1-nitropiperazine (CAS 1794753-23-3) is a chemical compound with the molecular formula C4H9N3O2 and a molecular weight of 139.18 g/mol. IUPAC name: 2,2,3,3,5,5,6,6-octadeuterio-1-nitropiperazine. InChIKey: KNZVXSFTGQDAPP-SVYQBANQSA-N.
| Molecular formula | C4H9N3O2 |
|---|---|
| Molecular weight | 139.18 g/mol |
| IUPAC name | 2,2,3,3,5,5,6,6-octadeuterio-1-nitropiperazine |
| InChIKey | KNZVXSFTGQDAPP-SVYQBANQSA-N |
| SMILES | [2H]C1(C(N(C(C(N1)([2H])[2H])([2H])[2H])[N+](=O)[O-])([2H])[2H])[2H] |
Computed by PubChem (NCBI)