CAS 1821337-41-0 is the registry number for 3-Guanidinopropionic Acid-D4. Offered by: TRC. Available pack sizes: 100mg, 10mg.
2,2,3,3-tetradeuterio-3-(diaminomethylideneamino)propanoic acid (CAS 1821337-41-0) is a chemical compound with the molecular formula C4H9N3O2 and a molecular weight of 135.16 g/mol. IUPAC name: 2,2,3,3-tetradeuterio-3-(diaminomethylideneamino)propanoic acid. InChIKey: KMXXSJLYVJEBHI-LNLMKGTHSA-N.
| Molecular formula | C4H9N3O2 |
|---|---|
| Molecular weight | 135.16 g/mol |
| IUPAC name | 2,2,3,3-tetradeuterio-3-(diaminomethylideneamino)propanoic acid |
| InChIKey | KMXXSJLYVJEBHI-LNLMKGTHSA-N |
| SMILES | [2H]C([2H])(C(=O)O)C([2H])([2H])N=C(N)N |
Computed by PubChem (NCBI)