Products 1794753-49-3
CAS 1794753-49-3 appears in our catalog under these names: Tributyl O-Acetylcitrate-d3, Tri-n-butyl 2-Acetyl-d3-citrate, 99 atom % D, min 98% Chemical Purity, Tributyl 2–acetoxypropane–1,2,3–tricarboxylate–d3, Acetyl tributyl citrate-d3, 99.78%, D3-Tributyl O-Acetylcitrate. Offered by: TRC, CDN, GLPBio, MedChemExpress, HPC Standards. Available pack sizes: 50mg, 5mg, 0,1g, 0,05g, 1mg, 10mg, 1 mg, 5 mg.
Tributyl 2-(2,2,2-trideuterioacetyl)oxypropane-1,2,3-tricarboxylate (CAS 1794753-49-3) is a chemical compound with the molecular formula C20H34O8 and a molecular weight of 405.5 g/mol. IUPAC name: tributyl 2-(2,2,2-trideuterioacetyl)oxypropane-1,2,3-tricarboxylate. InChIKey: QZCLKYGREBVARF-GKOSEXJESA-N.
| Molecular formula | C20H34O8 |
|---|---|
| Molecular weight | 405.5 g/mol |
| IUPAC name | tributyl 2-(2,2,2-trideuterioacetyl)oxypropane-1,2,3-tricarboxylate |
| InChIKey | QZCLKYGREBVARF-GKOSEXJESA-N |
| SMILES | [2H]C([2H])([2H])C(=O)OC(CC(=O)OCCCC)(CC(=O)OCCCC)C(=O)OCCCC |
Computed by PubChem (NCBI)