Products 2901109-62-2

CAS 2901109-62-2 is the registry number for 5,5'-(Decane-1,10-diylbis(oxy))bis(5-oxopentanoic acid), 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

5-[10-(4-carboxybutanoyloxy)decoxy]-5-oxopentanoic acid (CAS 2901109-62-2) is a chemical compound with the molecular formula C20H34O8 and a molecular weight of 402.5 g/mol. IUPAC name: 5-[10-(4-carboxybutanoyloxy)decoxy]-5-oxopentanoic acid. InChIKey: FIMNJGUDSYGFOD-UHFFFAOYSA-N.

Identity
Molecular formulaC20H34O8
Molecular weight402.5 g/mol
IUPAC name5-[10-(4-carboxybutanoyloxy)decoxy]-5-oxopentanoic acid
InChIKeyFIMNJGUDSYGFOD-UHFFFAOYSA-N
SMILESC(CCCCCOC(=O)CCCC(=O)O)CCCCOC(=O)CCCC(=O)O

Computed by PubChem (NCBI)