Products 1794754-45-2
CAS 1794754-45-2 appears in our catalog under these names: p-Phenetidine-d5 Hydrochloride, 4-Ethoxyaniline-d5 (hydrochloride). Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
4-(1,1,2,2,2-pentadeuterioethoxy)aniline;hydrochloride (CAS 1794754-45-2) is a chemical compound with the molecular formula C8H12ClNO and a molecular weight of 178.67 g/mol. IUPAC name: 4-(1,1,2,2,2-pentadeuterioethoxy)aniline;hydrochloride. InChIKey: JVWYCUBGJVOEIZ-LUIAAVAXSA-N.
| Molecular formula | C8H12ClNO |
|---|---|
| Molecular weight | 178.67 g/mol |
| IUPAC name | 4-(1,1,2,2,2-pentadeuterioethoxy)aniline;hydrochloride |
| InChIKey | JVWYCUBGJVOEIZ-LUIAAVAXSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OC1=CC=C(C=C1)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
p-Phenetidine-d5 Hydrochloride