Products 1794779-79-5
CAS 1794779-79-5 is the registry number for Chlorpropamide-d4. Offered by: TRC. Available pack sizes: 100mg, 10mg.
1-(4-chloro-2,3,5,6-tetradeuteriophenyl)sulfonyl-3-propylurea (CAS 1794779-79-5) is a chemical compound with the molecular formula C10H13ClN2O3S and a molecular weight of 280.77 g/mol. IUPAC name: 1-(4-chloro-2,3,5,6-tetradeuteriophenyl)sulfonyl-3-propylurea. InChIKey: RKWGIWYCVPQPMF-LNFUJOGGSA-N.
| Molecular formula | C10H13ClN2O3S |
|---|---|
| Molecular weight | 280.77 g/mol |
| IUPAC name | 1-(4-chloro-2,3,5,6-tetradeuteriophenyl)sulfonyl-3-propylurea |
| InChIKey | RKWGIWYCVPQPMF-LNFUJOGGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1S(=O)(=O)NC(=O)NCCC)[2H])[2H])Cl)[2H] |
Computed by PubChem (NCBI)