CAS 379255-81-9 is the registry number for 2-Chloro-n-[2-(4-sulfamoyl-phenyl)-ethyl]-acetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-chloro-N-[2-(4-sulfamoylphenyl)ethyl]acetamide (CAS 379255-81-9) is a chemical compound with the molecular formula C10H13ClN2O3S and a molecular weight of 276.74 g/mol. IUPAC name: 2-chloro-N-[2-(4-sulfamoylphenyl)ethyl]acetamide. InChIKey: SPHVYECTYHWHJM-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2O3S |
|---|---|
| Molecular weight | 276.74 g/mol |
| IUPAC name | 2-chloro-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
| InChIKey | SPHVYECTYHWHJM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCNC(=O)CCl)S(=O)(=O)N |
Computed by PubChem (NCBI)