CAS 1794783-36-0 appears in our catalog under these names: Norepinephrine Impurity 13-d5, rac 3,4-Dihydroxyphenylethylene Glycol-d5, 4-(1,2-Dihydroxyethyl)benzene-1,2-diol-d5. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 10 mg, 1 mg.
3,4,6-trideuterio-5-(2,2-dideuterio-1,2-dihydroxyethyl)benzene-1,2-diol (CAS 1794783-36-0) is a chemical compound with the molecular formula C8H10O4 and a molecular weight of 175.19 g/mol. IUPAC name: 3,4,6-trideuterio-5-(2,2-dideuterio-1,2-dihydroxyethyl)benzene-1,2-diol. InChIKey: MTVWFVDWRVYDOR-QUWGTZMWSA-N.
| Molecular formula | C8H10O4 |
|---|---|
| Molecular weight | 175.19 g/mol |
| IUPAC name | 3,4,6-trideuterio-5-(2,2-dideuterio-1,2-dihydroxyethyl)benzene-1,2-diol |
| InChIKey | MTVWFVDWRVYDOR-QUWGTZMWSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C(C([2H])([2H])O)O)[2H])O)O)[2H] |
Computed by PubChem (NCBI)