Products 1794787-00-0
CAS 1794787-00-0 appears in our catalog under these names: 2-(4-Bromophenoxy)-N,N-dimethylethylamine-d6, 2-(4-Bromophenoxy)-N,N-dimethylethanamine-d6. Offered by: TRC, MedChemExpress. Available pack sizes: 50mg, 5mg, 50 mg, 5 mg.
2-(4-bromophenoxy)-N,N-bis(trideuteriomethyl)ethanamine (CAS 1794787-00-0) is a chemical compound with the molecular formula C10H14BrNO and a molecular weight of 250.16 g/mol. IUPAC name: 2-(4-bromophenoxy)-N,N-bis(trideuteriomethyl)ethanamine. InChIKey: MOVOYJFCKMYLHQ-WFGJKAKNSA-N.
| Molecular formula | C10H14BrNO |
|---|---|
| Molecular weight | 250.16 g/mol |
| IUPAC name | 2-(4-bromophenoxy)-N,N-bis(trideuteriomethyl)ethanamine |
| InChIKey | MOVOYJFCKMYLHQ-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])N(CCOC1=CC=C(C=C1)Br)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)