Products 1794811-42-9
CAS 1794811-42-9 appears in our catalog under these names: Mono(2-(carboxymethyl)hexyl) Phthalate-d4, >95% (HPLC), Mono[2-(carboxymethyl)hexyl] phthalate-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg.
2-[2-(carboxymethyl)hexoxycarbonyl]-3,4,5,6-tetradeuteriobenzoic acid (CAS 1794811-42-9) is a chemical compound with the molecular formula C16H20O6 and a molecular weight of 312.35 g/mol. IUPAC name: 2-[2-(carboxymethyl)hexoxycarbonyl]-3,4,5,6-tetradeuteriobenzoic acid. InChIKey: CCNOZWPVQWCJFK-YBNXMSKUSA-N.
| Molecular formula | C16H20O6 |
|---|---|
| Molecular weight | 312.35 g/mol |
| IUPAC name | 2-[2-(carboxymethyl)hexoxycarbonyl]-3,4,5,6-tetradeuteriobenzoic acid |
| InChIKey | CCNOZWPVQWCJFK-YBNXMSKUSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)O)C(=O)OCC(CCCC)CC(=O)O)[2H])[2H] |
Computed by PubChem (NCBI)