CAS 1794811-58-7 appears in our catalog under these names: Niflumic Acid-d5 (Major), >95% (HPLC), Niflumic acid-d5. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg, 1 mg, 10 mg.
4,5,6-trideuterio-2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylic acid (CAS 1794811-58-7) is a chemical compound with the molecular formula C13H9F3N2O2 and a molecular weight of 285.24 g/mol. IUPAC name: 4,5,6-trideuterio-2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylic acid. InChIKey: JZFPYUNJRRFVQU-UJESMPABSA-N.
| Molecular formula | C13H9F3N2O2 |
|---|---|
| Molecular weight | 285.24 g/mol |
| IUPAC name | 4,5,6-trideuterio-2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylic acid |
| InChIKey | JZFPYUNJRRFVQU-UJESMPABSA-N |
| SMILES | [2H]C1=C(C(=C(N=C1[2H])NC2=CC=CC(=C2)C(F)(F)F)C(=O)O)[2H] |
Computed by PubChem (NCBI)