CAS 856897-95-5 is the registry number for 3-Nitro-4′-(trifluoromethyl)(1,1′-biphenyl)-4-amine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
2-nitro-4-[4-(trifluoromethyl)phenyl]aniline (CAS 856897-95-5) is a chemical compound with the molecular formula C13H9F3N2O2 and a molecular weight of 282.22 g/mol. IUPAC name: 2-nitro-4-[4-(trifluoromethyl)phenyl]aniline. InChIKey: DGSNEOPSGFESJN-UHFFFAOYSA-N.
| Molecular formula | C13H9F3N2O2 |
|---|---|
| Molecular weight | 282.22 g/mol |
| IUPAC name | 2-nitro-4-[4-(trifluoromethyl)phenyl]aniline |
| InChIKey | DGSNEOPSGFESJN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=C(C=C2)N)[N+](=O)[O-])C(F)(F)F |
Computed by PubChem (NCBI)