CAS 1794897-96-3 appears in our catalog under these names: Nitroso Diisobutylamine-d4, N-Nitrosodiisobutylamine-d4, >95% (GC), Nitroso diisobutylamine–d4. Offered by: Chemat Brand, TRC, GLPBio, MedChemExpress. Available pack sizes: on request, 2,5mg, 25mg, 2500μg, 2.5 mg.
N,N-bis(1,1-dideuterio-2-methylpropyl)nitrous amide (CAS 1794897-96-3) is a chemical compound with the molecular formula C8H18N2O and a molecular weight of 162.27 g/mol. IUPAC name: N,N-bis(1,1-dideuterio-2-methylpropyl)nitrous amide. InChIKey: XLZCLFRMPCBSDI-NZLXMSDQSA-N.
| Molecular formula | C8H18N2O |
|---|---|
| Molecular weight | 162.27 g/mol |
| IUPAC name | N,N-bis(1,1-dideuterio-2-methylpropyl)nitrous amide |
| InChIKey | XLZCLFRMPCBSDI-NZLXMSDQSA-N |
| SMILES | [2H]C([2H])(C(C)C)N(C([2H])([2H])C(C)C)N=O |
Computed by PubChem (NCBI)