CAS 1794898-13-7 appears in our catalog under these names: Tetrahydro Curcumin-d6, >95% (HPLC), Tetrahydrocurcumin D6, Tetrahydrocurcumin-d6. Offered by: TRC, TargetMol, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 1 mg.
1,7-bis[4-hydroxy-3-(trideuteriomethoxy)phenyl]heptane-3,5-dione (CAS 1794898-13-7) is a chemical compound with the molecular formula C21H24O6 and a molecular weight of 378.4 g/mol. IUPAC name: 1,7-bis[4-hydroxy-3-(trideuteriomethoxy)phenyl]heptane-3,5-dione. InChIKey: LBTVHXHERHESKG-WFGJKAKNSA-N.
| Molecular formula | C21H24O6 |
|---|---|
| Molecular weight | 378.4 g/mol |
| IUPAC name | 1,7-bis[4-hydroxy-3-(trideuteriomethoxy)phenyl]heptane-3,5-dione |
| InChIKey | LBTVHXHERHESKG-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=CC(=C1)CCC(=O)CC(=O)CCC2=CC(=C(C=C2)O)OC([2H])([2H])[2H])O |
Computed by PubChem (NCBI)