Products 76549-35-4
CAS 76549-35-4 appears in our catalog under these names: Isovalerylshikonin, Isovalerylshikonin, 98.00% ,, 98.00% ,. Offered by: TargetMol, Biosynth, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 20mg.
[1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] 3-methylbutanoate (CAS 76549-35-4) is a chemical compound with the molecular formula C21H24O6 and a molecular weight of 372.4 g/mol. IUPAC name: [1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] 3-methylbutanoate. InChIKey: UTOUNDHZJFIVPK-UHFFFAOYSA-N.
| Molecular formula | C21H24O6 |
|---|---|
| Molecular weight | 372.4 g/mol |
| IUPAC name | [1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] 3-methylbutanoate |
| InChIKey | UTOUNDHZJFIVPK-UHFFFAOYSA-N |
| SMILES | CC(C)CC(=O)OC(CC=C(C)C)C1=CC(=O)C2=C(C=CC(=C2C1=O)O)O |
Computed by PubChem (NCBI)